C22H37N2O+ — CID 10140177
(2R)-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-[4-(2-methylpropyl)phenyl]propanamide (PubChem CID 10140177) has the molecular formula C22H37N2O+ and a molecular weight of 345.55 g/mol. Its IUPAC name is (2R)-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-[4-(2-methylpropyl)phenyl]propanamide.
| Compound Name | (2R)-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 10140177 |
| Molecular Formula | C22H37N2O+ |
| Molecular Weight | 345.55 g/mol |
| Exact Mass | 345.29 |
| IUPAC Name | (2R)-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
| SMILES | CC(C)Cc1ccc([C@@H](C)C(=O)NCCC[N+]2(C)CCCCC2)cc1 |
| InChI | InChI=1S/C22H36N2O/c1-18(2)17-20-9-11-21(12-10-20)19(3)22(25)23-13-8-16-24(4)14-6-5-7-15-24/h9-12,18-19H,5-8,13-17H2,1-4H3/p+1/t19-/m1/s1 |
| InChIKey | TWJDBOHTROXXQT-LJQANCHMSA-O |
| XLogP | 4.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|