C11H14Cl2N2O3S — CID 95282761
(2R)-2-(2,6-dichlorophenyl)-N-(2-sulfamoylethyl)propanamide (PubChem CID 95282761) has the molecular formula C11H14Cl2N2O3S and a molecular weight of 325.22 g/mol. Its IUPAC name is (2R)-2-(2,6-dichlorophenyl)-N-(2-sulfamoylethyl)propanamide.
| Compound Name | (2R)-2-(2,6-dichlorophenyl)-N-(2-sulfamoylethyl)propanamide |
|---|---|
| PubChem CID | 95282761 |
| Molecular Formula | C11H14Cl2N2O3S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | (2R)-2-(2,6-dichlorophenyl)-N-(2-sulfamoylethyl)propanamide |
| SMILES | C[C@@H](C(=O)NCCS(N)(=O)=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H14Cl2N2O3S/c1-7(10-8(12)3-2-4-9(10)13)11(16)15-5-6-19(14,17)18/h2-4,7H,5-6H2,1H3,(H,15,16)(H2,14,17,18)/t7-/m1/s1 |
| InChIKey | ZVLRDIMOTKXZMK-SSDOTTSWSA-N |
| XLogP | 1.50 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |