C9H11ClIN3O3S — CID 112837932
1-(2-chloro-4-iodophenyl)-3-(2-sulfamoylethyl)urea (PubChem CID 112837932) has the molecular formula C9H11ClIN3O3S and a molecular weight of 403.63 g/mol. Its IUPAC name is 1-(2-chloro-4-iodophenyl)-3-(2-sulfamoylethyl)urea.
| Compound Name | 1-(2-chloro-4-iodophenyl)-3-(2-sulfamoylethyl)urea |
|---|---|
| PubChem CID | 112837932 |
| Molecular Formula | C9H11ClIN3O3S |
| Molecular Weight | 403.63 g/mol |
| Exact Mass | 402.93 |
| IUPAC Name | 1-(2-chloro-4-iodophenyl)-3-(2-sulfamoylethyl)urea |
| SMILES | NS(=O)(=O)CCNC(=O)Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C9H11ClIN3O3S/c10-7-5-6(11)1-2-8(7)14-9(15)13-3-4-18(12,16)17/h1-2,5H,3-4H2,(H2,12,16,17)(H2,13,14,15) |
| InChIKey | MIUXBYNEMOGWSF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.63 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|