C9H7ClF3IN2O — CID 113224209
1-(2-chloro-4-iodophenyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 113224209) has the molecular formula C9H7ClF3IN2O and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-(2-chloro-4-iodophenyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2-chloro-4-iodophenyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 113224209 |
| Molecular Formula | C9H7ClF3IN2O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 377.92 |
| IUPAC Name | 1-(2-chloro-4-iodophenyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C9H7ClF3IN2O/c10-6-3-5(14)1-2-7(6)16-8(17)15-4-9(11,12)13/h1-3H,4H2,(H2,15,16,17) |
| InChIKey | ZUXXDENVZQODCM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|