C9H7Cl2F3N2O2 — CID 113457028
1-(3,5-dichloro-4-hydroxyphenyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 113457028) has the molecular formula C9H7Cl2F3N2O2 and a molecular weight of 303.07 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-hydroxyphenyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(3,5-dichloro-4-hydroxyphenyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 113457028 |
| Molecular Formula | C9H7Cl2F3N2O2 |
| Molecular Weight | 303.07 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 1-(3,5-dichloro-4-hydroxyphenyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C9H7Cl2F3N2O2/c10-5-1-4(2-6(11)7(5)17)16-8(18)15-3-9(12,13)14/h1-2,17H,3H2,(H2,15,16,18) |
| InChIKey | HPLTURWCQOUPOZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.07 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|