C10H9Cl2F3N2O2 — CID 104786861
N-(3,5-dichloro-4-hydroxyphenyl)-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 104786861) has the molecular formula C10H9Cl2F3N2O2 and a molecular weight of 317.09 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-2-(2,2,2-trifluoroethylamino)acetamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-2-(2,2,2-trifluoroethylamino)acetamide |
|---|---|
| PubChem CID | 104786861 |
| Molecular Formula | C10H9Cl2F3N2O2 |
| Molecular Weight | 317.09 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | O=C(CNCC(F)(F)F)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2F3N2O2/c11-6-1-5(2-7(12)9(6)19)17-8(18)3-16-4-10(13,14)15/h1-2,16,19H,3-4H2,(H,17,18) |
| InChIKey | NRIMWUKFEOBZOC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.09 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|