C10H10BrF3N2O2 — CID 115870397
1-(3-bromo-5-methoxyphenyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 115870397) has the molecular formula C10H10BrF3N2O2 and a molecular weight of 327.10 g/mol. Its IUPAC name is 1-(3-bromo-5-methoxyphenyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(3-bromo-5-methoxyphenyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 115870397 |
| Molecular Formula | C10H10BrF3N2O2 |
| Molecular Weight | 327.10 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 1-(3-bromo-5-methoxyphenyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | COc1cc(Br)cc(NC(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H10BrF3N2O2/c1-18-8-3-6(11)2-7(4-8)16-9(17)15-5-10(12,13)14/h2-4H,5H2,1H3,(H2,15,16,17) |
| InChIKey | YPNOLCZMNQKHTO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.10 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |