C10H11BrF3NO — CID 82867863
3-bromo-5-methoxy-N-(3,3,3-trifluoropropyl)aniline (PubChem CID 82867863) has the molecular formula C10H11BrF3NO and a molecular weight of 298.10 g/mol. Its IUPAC name is 3-bromo-5-methoxy-N-(3,3,3-trifluoropropyl)aniline.
| Compound Name | 3-bromo-5-methoxy-N-(3,3,3-trifluoropropyl)aniline |
|---|---|
| PubChem CID | 82867863 |
| Molecular Formula | C10H11BrF3NO |
| Molecular Weight | 298.10 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 3-bromo-5-methoxy-N-(3,3,3-trifluoropropyl)aniline |
| SMILES | COc1cc(Br)cc(NCCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H11BrF3NO/c1-16-9-5-7(11)4-8(6-9)15-3-2-10(12,13)14/h4-6,15H,2-3H2,1H3 |
| InChIKey | UNBJJBNVKVJILH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.10 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |