C14H21BrN2O2 — CID 82868226
3-amino-N-(3-bromo-5-methoxyphenyl)-4,4-dimethylpentanamide (PubChem CID 82868226) has the molecular formula C14H21BrN2O2 and a molecular weight of 329.24 g/mol. Its IUPAC name is 3-amino-N-(3-bromo-5-methoxyphenyl)-4,4-dimethylpentanamide.
| Compound Name | 3-amino-N-(3-bromo-5-methoxyphenyl)-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 82868226 |
| Molecular Formula | C14H21BrN2O2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 3-amino-N-(3-bromo-5-methoxyphenyl)-4,4-dimethylpentanamide |
| SMILES | COc1cc(Br)cc(NC(=O)CC(N)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H21BrN2O2/c1-14(2,3)12(16)8-13(18)17-10-5-9(15)6-11(7-10)19-4/h5-7,12H,8,16H2,1-4H3,(H,17,18) |
| InChIKey | IEFXRNWGIVAABX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |