C13H10BrF3N2O — CID 115701817
1-(6-bromonaphthalen-2-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 115701817) has the molecular formula C13H10BrF3N2O and a molecular weight of 347.13 g/mol. Its IUPAC name is 1-(6-bromonaphthalen-2-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(6-bromonaphthalen-2-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 115701817 |
| Molecular Formula | C13H10BrF3N2O |
| Molecular Weight | 347.13 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 1-(6-bromonaphthalen-2-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)Nc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C13H10BrF3N2O/c14-10-3-1-9-6-11(4-2-8(9)5-10)19-12(20)18-7-13(15,16)17/h1-6H,7H2,(H2,18,19,20) |
| InChIKey | RKTSUFYZXXZGJB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.13 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |