C9H8ClF3N2O2 — CID 113463001
1-(4-chloro-3-hydroxyphenyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 113463001) has the molecular formula C9H8ClF3N2O2 and a molecular weight of 268.62 g/mol. Its IUPAC name is 1-(4-chloro-3-hydroxyphenyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(4-chloro-3-hydroxyphenyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 113463001 |
| Molecular Formula | C9H8ClF3N2O2 |
| Molecular Weight | 268.62 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 1-(4-chloro-3-hydroxyphenyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)Nc1ccc(Cl)c(O)c1 |
| InChI | InChI=1S/C9H8ClF3N2O2/c10-6-2-1-5(3-7(6)16)15-8(17)14-4-9(11,12)13/h1-3,16H,4H2,(H2,14,15,17) |
| InChIKey | CUBCLODJRWZBJF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |