C9H7ClF3NO2 — CID 64786329
N-(4-chloro-3-hydroxyphenyl)-3,3,3-trifluoropropanamide (PubChem CID 64786329) has the molecular formula C9H7ClF3NO2 and a molecular weight of 253.61 g/mol. Its IUPAC name is N-(4-chloro-3-hydroxyphenyl)-3,3,3-trifluoropropanamide.
| Compound Name | N-(4-chloro-3-hydroxyphenyl)-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 64786329 |
| Molecular Formula | C9H7ClF3NO2 |
| Molecular Weight | 253.61 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | N-(4-chloro-3-hydroxyphenyl)-3,3,3-trifluoropropanamide |
| SMILES | O=C(CC(F)(F)F)Nc1ccc(Cl)c(O)c1 |
| InChI | InChI=1S/C9H7ClF3NO2/c10-6-2-1-5(3-7(6)15)14-8(16)4-9(11,12)13/h1-3,15H,4H2,(H,14,16) |
| InChIKey | CTCPLVMSNRNFMX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.61 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |