C11H10ClF3N4O4 — CID 55818009
2-[(4-chloro-3-nitrophenyl)carbamoylamino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 55818009) has the molecular formula C11H10ClF3N4O4 and a molecular weight of 354.67 g/mol. Its IUPAC name is 2-[(4-chloro-3-nitrophenyl)carbamoylamino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[(4-chloro-3-nitrophenyl)carbamoylamino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 55818009 |
| Molecular Formula | C11H10ClF3N4O4 |
| Molecular Weight | 354.67 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 2-[(4-chloro-3-nitrophenyl)carbamoylamino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CNC(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1)NCC(F)(F)F |
| InChI | InChI=1S/C11H10ClF3N4O4/c12-7-2-1-6(3-8(7)19(22)23)18-10(21)16-4-9(20)17-5-11(13,14)15/h1-3H,4-5H2,(H,17,20)(H2,16,18,21) |
| InChIKey | SVISWUGRLFTJRV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.67 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|