C15H10ClF2N3O4 — CID 7930157
4-chloro-N-[2-(3,4-difluoroanilino)-2-oxoethyl]-3-nitrobenzamide (PubChem CID 7930157) has the molecular formula C15H10ClF2N3O4 and a molecular weight of 369.71 g/mol. Its IUPAC name is 4-chloro-N-[2-(3,4-difluoroanilino)-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[2-(3,4-difluoroanilino)-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 7930157 |
| Molecular Formula | C15H10ClF2N3O4 |
| Molecular Weight | 369.71 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 4-chloro-N-[2-(3,4-difluoroanilino)-2-oxoethyl]-3-nitrobenzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H10ClF2N3O4/c16-10-3-1-8(5-13(10)21(24)25)15(23)19-7-14(22)20-9-2-4-11(17)12(18)6-9/h1-6H,7H2,(H,19,23)(H,20,22) |
| InChIKey | KBNTVPNZZLAQGA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.71 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|