C12H10BrF3N2O2S — CID 114808909
6-bromo-N-(2,2,2-trifluoroethylsulfamoyl)naphthalen-2-amine (PubChem CID 114808909) has the molecular formula C12H10BrF3N2O2S and a molecular weight of 383.19 g/mol. Its IUPAC name is 6-bromo-N-(2,2,2-trifluoroethylsulfamoyl)naphthalen-2-amine.
| Compound Name | 6-bromo-N-(2,2,2-trifluoroethylsulfamoyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 114808909 |
| Molecular Formula | C12H10BrF3N2O2S |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | 6-bromo-N-(2,2,2-trifluoroethylsulfamoyl)naphthalen-2-amine |
| SMILES | O=S(=O)(NCC(F)(F)F)Nc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C12H10BrF3N2O2S/c13-10-3-1-9-6-11(4-2-8(9)5-10)18-21(19,20)17-7-12(14,15)16/h1-6,17-18H,7H2 |
| InChIKey | BSUICBIRXMAMRU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |