C8H8BrF3N2O2S — CID 114808728
4-bromo-N-(2,2,2-trifluoroethylsulfamoyl)aniline (PubChem CID 114808728) has the molecular formula C8H8BrF3N2O2S and a molecular weight of 333.13 g/mol. Its IUPAC name is 4-bromo-N-(2,2,2-trifluoroethylsulfamoyl)aniline.
| Compound Name | 4-bromo-N-(2,2,2-trifluoroethylsulfamoyl)aniline |
|---|---|
| PubChem CID | 114808728 |
| Molecular Formula | C8H8BrF3N2O2S |
| Molecular Weight | 333.13 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | 4-bromo-N-(2,2,2-trifluoroethylsulfamoyl)aniline |
| SMILES | O=S(=O)(NCC(F)(F)F)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C8H8BrF3N2O2S/c9-6-1-3-7(4-2-6)14-17(15,16)13-5-8(10,11)12/h1-4,13-14H,5H2 |
| InChIKey | GNTKXLKXOXCUOV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.13 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |