C9H11BrF3N3O2S — CID 114804603
5-bromo-3-methyl-2-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,2-diamine (PubChem CID 114804603) has the molecular formula C9H11BrF3N3O2S and a molecular weight of 362.17 g/mol. Its IUPAC name is 5-bromo-3-methyl-2-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,2-diamine.
| Compound Name | 5-bromo-3-methyl-2-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 114804603 |
| Molecular Formula | C9H11BrF3N3O2S |
| Molecular Weight | 362.17 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 5-bromo-3-methyl-2-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,2-diamine |
| SMILES | Cc1cc(Br)cc(N)c1NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H11BrF3N3O2S/c1-5-2-6(10)3-7(14)8(5)16-19(17,18)15-4-9(11,12)13/h2-3,15-16H,4,14H2,1H3 |
| InChIKey | GRBDBTHFAOZOIT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|