C10H16BrN3O2S — CID 114804604
5-bromo-3-methyl-2-N-(propan-2-ylsulfamoyl)benzene-1,2-diamine (PubChem CID 114804604) has the molecular formula C10H16BrN3O2S and a molecular weight of 322.23 g/mol. Its IUPAC name is 5-bromo-3-methyl-2-N-(propan-2-ylsulfamoyl)benzene-1,2-diamine.
| Compound Name | 5-bromo-3-methyl-2-N-(propan-2-ylsulfamoyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 114804604 |
| Molecular Formula | C10H16BrN3O2S |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 5-bromo-3-methyl-2-N-(propan-2-ylsulfamoyl)benzene-1,2-diamine |
| SMILES | Cc1cc(Br)cc(N)c1NS(=O)(=O)NC(C)C |
| InChI | InChI=1S/C10H16BrN3O2S/c1-6(2)13-17(15,16)14-10-7(3)4-8(11)5-9(10)12/h4-6,13-14H,12H2,1-3H3 |
| InChIKey | YHYGVYFVCHCALO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|