C10H17N3O2S — CID 114804316
4-methyl-1-N-(propan-2-ylsulfamoyl)benzene-1,2-diamine (PubChem CID 114804316) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 4-methyl-1-N-(propan-2-ylsulfamoyl)benzene-1,2-diamine.
| Compound Name | 4-methyl-1-N-(propan-2-ylsulfamoyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 114804316 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 4-methyl-1-N-(propan-2-ylsulfamoyl)benzene-1,2-diamine |
| SMILES | Cc1ccc(NS(=O)(=O)NC(C)C)c(N)c1 |
| InChI | InChI=1S/C10H17N3O2S/c1-7(2)12-16(14,15)13-10-5-4-8(3)6-9(10)11/h4-7,12-13H,11H2,1-3H3 |
| InChIKey | ZBQDFYJVNYPBHD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|