About 1-N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)benzene-1,4-diamine
1-N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 114804552) has the molecular formula C10H14F3N3O2S
and a molecular weight of 297.30 g/mol. Its IUPAC name is 1-N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)benzene-1,4-diamine.
Molecular Properties
| Compound Name | 1-N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)benzene-1,4-diamine |
| PubChem CID | 114804552 |
| Molecular Formula | C10H14F3N3O2S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CC(C)NS(=O)(=O)Nc1ccc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C10H14F3N3O2S/c1-6(2)15-19(17,18)16-9-4-3-7(14)5-8(9)10(11,12)13/h3-6,15-16H,14H2,1-2H3 |
| InChIKey | MDBBDDSXXJLPDO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)benzene-1,4-diamine?
The IUPAC name of 1-N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)benzene-1,4-diamine (CID 114804552) is 1-N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)benzene-1,4-diamine.
What is the SMILES notation for 1-N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)benzene-1,4-diamine?
The canonical SMILES for 1-N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)benzene-1,4-diamine is CC(C)NS(=O)(=O)Nc1ccc(N)cc1C(F)(F)F.
What is the InChIKey of 1-N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)benzene-1,4-diamine?
The InChIKey is MDBBDDSXXJLPDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N3O2S/c1-6(2)15-19(17,18)16-9-4-3-7(14)5-8(9)10(11,12)13/h3-6,15-16H,14H2,1-2H3.
What are the key properties of 1-N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)benzene-1,4-diamine?
1-N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)benzene-1,4-diamine has a molecular weight of 297.30 g/mol, XLogP of 1.94, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)benzene-1,4-diamine is sourced from PubChem (CID 114804552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).