C10H13F3N2O2S — CID 12503957
N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)aniline (PubChem CID 12503957) has the molecular formula C10H13F3N2O2S and a molecular weight of 282.29 g/mol. Its IUPAC name is N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)aniline.
| Compound Name | N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 12503957 |
| Molecular Formula | C10H13F3N2O2S |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | N-(propan-2-ylsulfamoyl)-2-(trifluoromethyl)aniline |
| SMILES | CC(C)NS(=O)(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O2S/c1-7(2)14-18(16,17)15-9-6-4-3-5-8(9)10(11,12)13/h3-7,14-15H,1-2H3 |
| InChIKey | CCBIPVVBQFWAPY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |