C17H18F3NO2S — CID 22774163
4-butan-2-yl-N-[2-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 22774163) has the molecular formula C17H18F3NO2S and a molecular weight of 357.40 g/mol. Its IUPAC name is 4-butan-2-yl-N-[2-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-butan-2-yl-N-[2-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22774163 |
| Molecular Formula | C17H18F3NO2S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 4-butan-2-yl-N-[2-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | CCC(C)c1ccc(S(=O)(=O)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H18F3NO2S/c1-3-12(2)13-8-10-14(11-9-13)24(22,23)21-16-7-5-4-6-15(16)17(18,19)20/h4-12,21H,3H2,1-2H3 |
| InChIKey | GMFOCJZSPYLSJV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |