C16H17F2NO2S — CID 8500871
4-[(2S)-butan-2-yl]-N-(2,6-difluorophenyl)benzenesulfonamide (PubChem CID 8500871) has the molecular formula C16H17F2NO2S and a molecular weight of 325.38 g/mol. Its IUPAC name is 4-[(2S)-butan-2-yl]-N-(2,6-difluorophenyl)benzenesulfonamide.
| Compound Name | 4-[(2S)-butan-2-yl]-N-(2,6-difluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 8500871 |
| Molecular Formula | C16H17F2NO2S |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 4-[(2S)-butan-2-yl]-N-(2,6-difluorophenyl)benzenesulfonamide |
| SMILES | CC[C@H](C)c1ccc(S(=O)(=O)Nc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C16H17F2NO2S/c1-3-11(2)12-7-9-13(10-8-12)22(20,21)19-16-14(17)5-4-6-15(16)18/h4-11,19H,3H2,1-2H3/t11-/m0/s1 |
| InChIKey | XDIRKOSAUQLMPR-NSHDSACASA-N |
| XLogP | 4.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |