C17H20FNO2S — CID 8523559
4-[(2S)-butan-2-yl]-N-(2-fluoro-5-methylphenyl)benzenesulfonamide (PubChem CID 8523559) has the molecular formula C17H20FNO2S and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-[(2S)-butan-2-yl]-N-(2-fluoro-5-methylphenyl)benzenesulfonamide.
| Compound Name | 4-[(2S)-butan-2-yl]-N-(2-fluoro-5-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 8523559 |
| Molecular Formula | C17H20FNO2S |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 4-[(2S)-butan-2-yl]-N-(2-fluoro-5-methylphenyl)benzenesulfonamide |
| SMILES | CC[C@H](C)c1ccc(S(=O)(=O)Nc2cc(C)ccc2F)cc1 |
| InChI | InChI=1S/C17H20FNO2S/c1-4-13(3)14-6-8-15(9-7-14)22(20,21)19-17-11-12(2)5-10-16(17)18/h5-11,13,19H,4H2,1-3H3/t13-/m0/s1 |
| InChIKey | AYUNUDDZWVMSBO-ZDUSSCGKSA-N |
| XLogP | 4.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |