C22H31NO2S — CID 19683986
4-butan-2-yl-N-[2,6-di(propan-2-yl)phenyl]benzenesulfonamide (PubChem CID 19683986) has the molecular formula C22H31NO2S and a molecular weight of 373.56 g/mol. Its IUPAC name is 4-butan-2-yl-N-[2,6-di(propan-2-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-butan-2-yl-N-[2,6-di(propan-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19683986 |
| Molecular Formula | C22H31NO2S |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 4-butan-2-yl-N-[2,6-di(propan-2-yl)phenyl]benzenesulfonamide |
| SMILES | CCC(C)c1ccc(S(=O)(=O)Nc2c(C(C)C)cccc2C(C)C)cc1 |
| InChI | InChI=1S/C22H31NO2S/c1-7-17(6)18-11-13-19(14-12-18)26(24,25)23-22-20(15(2)3)9-8-10-21(22)16(4)5/h8-17,23H,7H2,1-6H3 |
| InChIKey | PWGCEBAKLMSUCD-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |