About 4-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)benzenesulfonamide
4-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)benzenesulfonamide (PubChem CID 8504699) has the molecular formula C18H23NO2S
and a molecular weight of 317.45 g/mol. Its IUPAC name is 4-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)benzenesulfonamide |
| PubChem CID | 8504699 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)benzenesulfonamide |
| SMILES | CC[C@@H](C)c1ccc(S(=O)(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C18H23NO2S/c1-5-13(2)16-9-11-17(12-10-16)22(20,21)19-18-14(3)7-6-8-15(18)4/h6-13,19H,5H2,1-4H3/t13-/m1/s1 |
| InChIKey | URPBUVRAZBOCIL-CYBMUJFWSA-N |
| XLogP | 4.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)benzenesulfonamide?
The IUPAC name of 4-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)benzenesulfonamide (CID 8504699) is 4-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)benzenesulfonamide.
What is the SMILES notation for 4-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)benzenesulfonamide?
The canonical SMILES for 4-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)benzenesulfonamide is CC[C@@H](C)c1ccc(S(=O)(=O)Nc2c(C)cccc2C)cc1.
What is the InChIKey of 4-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)benzenesulfonamide?
The InChIKey is URPBUVRAZBOCIL-CYBMUJFWSA-N. The full InChI is InChI=1S/C18H23NO2S/c1-5-13(2)16-9-11-17(12-10-16)22(20,21)19-18-14(3)7-6-8-15(18)4/h6-13,19H,5H2,1-4H3/t13-/m1/s1.
What are the key properties of 4-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)benzenesulfonamide?
4-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)benzenesulfonamide has a molecular weight of 317.45 g/mol, XLogP of 4.62, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)benzenesulfonamide is sourced from PubChem (CID 8504699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).