C12H17N3O2S — CID 114812041
2-(3-aminoprop-1-ynyl)-N-(propan-2-ylsulfamoyl)aniline (PubChem CID 114812041) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)-N-(propan-2-ylsulfamoyl)aniline.
| Compound Name | 2-(3-aminoprop-1-ynyl)-N-(propan-2-ylsulfamoyl)aniline |
|---|---|
| PubChem CID | 114812041 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)-N-(propan-2-ylsulfamoyl)aniline |
| SMILES | CC(C)NS(=O)(=O)Nc1ccccc1C#CCN |
| InChI | InChI=1S/C12H17N3O2S/c1-10(2)14-18(16,17)15-12-8-4-3-6-11(12)7-5-9-13/h3-4,6,8,10,14-15H,9,13H2,1-2H3 |
| InChIKey | BDVPRCKHEYVBCE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|