C12H15ClN2O3S — CID 114811993
3-[4-chloro-2-(propan-2-ylsulfamoylamino)phenyl]prop-2-yn-1-ol (PubChem CID 114811993) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is 3-[4-chloro-2-(propan-2-ylsulfamoylamino)phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[4-chloro-2-(propan-2-ylsulfamoylamino)phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 114811993 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 3-[4-chloro-2-(propan-2-ylsulfamoylamino)phenyl]prop-2-yn-1-ol |
| SMILES | CC(C)NS(=O)(=O)Nc1cc(Cl)ccc1C#CCO |
| InChI | InChI=1S/C12H15ClN2O3S/c1-9(2)14-19(17,18)15-12-8-11(13)6-5-10(12)4-3-7-16/h5-6,8-9,14-16H,7H2,1-2H3 |
| InChIKey | PWOMYMGOVAWNFW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|