C12H16ClN3O2S — CID 114812221
2-(3-aminoprop-1-ynyl)-5-chloro-N-(propylsulfamoyl)aniline (PubChem CID 114812221) has the molecular formula C12H16ClN3O2S and a molecular weight of 301.80 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)-5-chloro-N-(propylsulfamoyl)aniline.
| Compound Name | 2-(3-aminoprop-1-ynyl)-5-chloro-N-(propylsulfamoyl)aniline |
|---|---|
| PubChem CID | 114812221 |
| Molecular Formula | C12H16ClN3O2S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)-5-chloro-N-(propylsulfamoyl)aniline |
| SMILES | CCCNS(=O)(=O)Nc1cc(Cl)ccc1C#CCN |
| InChI | InChI=1S/C12H16ClN3O2S/c1-2-8-15-19(17,18)16-12-9-11(13)6-5-10(12)4-3-7-14/h5-6,9,15-16H,2,7-8,14H2,1H3 |
| InChIKey | WPVDCZBPIDCQKJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|