C12H16FN3O3S — CID 114816543
4-(3-aminoprop-1-ynyl)-3-fluoro-N-(2-methoxyethylsulfamoyl)aniline (PubChem CID 114816543) has the molecular formula C12H16FN3O3S and a molecular weight of 301.34 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-3-fluoro-N-(2-methoxyethylsulfamoyl)aniline.
| Compound Name | 4-(3-aminoprop-1-ynyl)-3-fluoro-N-(2-methoxyethylsulfamoyl)aniline |
|---|---|
| PubChem CID | 114816543 |
| Molecular Formula | C12H16FN3O3S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-3-fluoro-N-(2-methoxyethylsulfamoyl)aniline |
| SMILES | COCCNS(=O)(=O)Nc1ccc(C#CCN)c(F)c1 |
| InChI | InChI=1S/C12H16FN3O3S/c1-19-8-7-15-20(17,18)16-11-5-4-10(3-2-6-14)12(13)9-11/h4-5,9,15-16H,6-8,14H2,1H3 |
| InChIKey | PLZGIOADICGEMV-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|