C12H15N3O4S — CID 114465787
methyl N-[[4-(3-aminoprop-1-ynyl)-3-methylphenyl]sulfamoyl]carbamate (PubChem CID 114465787) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is methyl N-[[4-(3-aminoprop-1-ynyl)-3-methylphenyl]sulfamoyl]carbamate.
| Compound Name | methyl N-[[4-(3-aminoprop-1-ynyl)-3-methylphenyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114465787 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | methyl N-[[4-(3-aminoprop-1-ynyl)-3-methylphenyl]sulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)Nc1ccc(C#CCN)c(C)c1 |
| InChI | InChI=1S/C12H15N3O4S/c1-9-8-11(6-5-10(9)4-3-7-13)14-20(17,18)15-12(16)19-2/h5-6,8,14H,7,13H2,1-2H3,(H,15,16) |
| InChIKey | FOXKHFYNYIGJGP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|