C12H16N2O4S2 — CID 82842279
N-[3-(3-aminoprop-1-ynyl)-4-methylphenyl]-1-methylsulfonylmethanesulfonamide (PubChem CID 82842279) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[3-(3-aminoprop-1-ynyl)-4-methylphenyl]-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-[3-(3-aminoprop-1-ynyl)-4-methylphenyl]-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 82842279 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-[3-(3-aminoprop-1-ynyl)-4-methylphenyl]-1-methylsulfonylmethanesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)CS(C)(=O)=O)cc1C#CCN |
| InChI | InChI=1S/C12H16N2O4S2/c1-10-5-6-12(8-11(10)4-3-7-13)14-20(17,18)9-19(2,15)16/h5-6,8,14H,7,9,13H2,1-2H3 |
| InChIKey | QWVMKGMKOMJNFM-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|