C13H18N2O4S2 — CID 82834855
N-[4-(3-aminoprop-1-ynyl)-2-ethylphenyl]-1-methylsulfonylmethanesulfonamide (PubChem CID 82834855) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[4-(3-aminoprop-1-ynyl)-2-ethylphenyl]-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-[4-(3-aminoprop-1-ynyl)-2-ethylphenyl]-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 82834855 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-[4-(3-aminoprop-1-ynyl)-2-ethylphenyl]-1-methylsulfonylmethanesulfonamide |
| SMILES | CCc1cc(C#CCN)ccc1NS(=O)(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C13H18N2O4S2/c1-3-12-9-11(5-4-8-14)6-7-13(12)15-21(18,19)10-20(2,16)17/h6-7,9,15H,3,8,10,14H2,1-2H3 |
| InChIKey | FDBTVZSVYVMXPZ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|