C11H17N3O5S — CID 114467010
methyl N-[[3-(aminomethyl)-4-ethoxyphenyl]sulfamoyl]carbamate (PubChem CID 114467010) has the molecular formula C11H17N3O5S and a molecular weight of 303.34 g/mol. Its IUPAC name is methyl N-[[3-(aminomethyl)-4-ethoxyphenyl]sulfamoyl]carbamate.
| Compound Name | methyl N-[[3-(aminomethyl)-4-ethoxyphenyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114467010 |
| Molecular Formula | C11H17N3O5S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | methyl N-[[3-(aminomethyl)-4-ethoxyphenyl]sulfamoyl]carbamate |
| SMILES | CCOc1ccc(NS(=O)(=O)NC(=O)OC)cc1CN |
| InChI | InChI=1S/C11H17N3O5S/c1-3-19-10-5-4-9(6-8(10)7-12)13-20(16,17)14-11(15)18-2/h4-6,13H,3,7,12H2,1-2H3,(H,14,15) |
| InChIKey | QQEUOYFUWFHPLH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |