C9H11ClN2O4S — CID 114466361
methyl N-[[4-(chloromethyl)phenyl]sulfamoyl]carbamate (PubChem CID 114466361) has the molecular formula C9H11ClN2O4S and a molecular weight of 278.72 g/mol. Its IUPAC name is methyl N-[[4-(chloromethyl)phenyl]sulfamoyl]carbamate.
| Compound Name | methyl N-[[4-(chloromethyl)phenyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114466361 |
| Molecular Formula | C9H11ClN2O4S |
| Molecular Weight | 278.72 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | methyl N-[[4-(chloromethyl)phenyl]sulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)Nc1ccc(CCl)cc1 |
| InChI | InChI=1S/C9H11ClN2O4S/c1-16-9(13)12-17(14,15)11-8-4-2-7(6-10)3-5-8/h2-5,11H,6H2,1H3,(H,12,13) |
| InChIKey | KDMHIRHCSYIKNF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.72 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|