C8H8BrClN2O4S — CID 107612728
methyl N-[(4-bromo-3-chlorophenyl)sulfamoyl]carbamate (PubChem CID 107612728) has the molecular formula C8H8BrClN2O4S and a molecular weight of 343.59 g/mol. Its IUPAC name is methyl N-[(4-bromo-3-chlorophenyl)sulfamoyl]carbamate.
| Compound Name | methyl N-[(4-bromo-3-chlorophenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 107612728 |
| Molecular Formula | C8H8BrClN2O4S |
| Molecular Weight | 343.59 g/mol |
| Exact Mass | 341.91 |
| IUPAC Name | methyl N-[(4-bromo-3-chlorophenyl)sulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C8H8BrClN2O4S/c1-16-8(13)12-17(14,15)11-5-2-3-6(9)7(10)4-5/h2-4,11H,1H3,(H,12,13) |
| InChIKey | JUOCFCAOLXACML-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.59 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |