C9H10BrClN2O4S — CID 114463867
ethyl N-[(3-bromo-4-chlorophenyl)sulfamoyl]carbamate (PubChem CID 114463867) has the molecular formula C9H10BrClN2O4S and a molecular weight of 357.61 g/mol. Its IUPAC name is ethyl N-[(3-bromo-4-chlorophenyl)sulfamoyl]carbamate.
| Compound Name | ethyl N-[(3-bromo-4-chlorophenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114463867 |
| Molecular Formula | C9H10BrClN2O4S |
| Molecular Weight | 357.61 g/mol |
| Exact Mass | 355.92 |
| IUPAC Name | ethyl N-[(3-bromo-4-chlorophenyl)sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)Nc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C9H10BrClN2O4S/c1-2-17-9(14)13-18(15,16)12-6-3-4-8(11)7(10)5-6/h3-5,12H,2H2,1H3,(H,13,14) |
| InChIKey | KEHVLQGRBWYFOQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.61 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |