C11H11ClN4O4S — CID 102990345
ethyl N-[(3-chloroquinoxalin-2-yl)sulfamoyl]carbamate (PubChem CID 102990345) has the molecular formula C11H11ClN4O4S and a molecular weight of 330.75 g/mol. Its IUPAC name is ethyl N-[(3-chloroquinoxalin-2-yl)sulfamoyl]carbamate.
| Compound Name | ethyl N-[(3-chloroquinoxalin-2-yl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 102990345 |
| Molecular Formula | C11H11ClN4O4S |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | ethyl N-[(3-chloroquinoxalin-2-yl)sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)Nc1nc2ccccc2nc1Cl |
| InChI | InChI=1S/C11H11ClN4O4S/c1-2-20-11(17)16-21(18,19)15-10-9(12)13-7-5-3-4-6-8(7)14-10/h3-6H,2H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | WZMATXNMJVKLEB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |