C7H8Cl2N4O4S — CID 114049152
ethyl N-[(5,6-dichloropyrimidin-4-yl)sulfamoyl]carbamate (PubChem CID 114049152) has the molecular formula C7H8Cl2N4O4S and a molecular weight of 315.14 g/mol. Its IUPAC name is ethyl N-[(5,6-dichloropyrimidin-4-yl)sulfamoyl]carbamate.
| Compound Name | ethyl N-[(5,6-dichloropyrimidin-4-yl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114049152 |
| Molecular Formula | C7H8Cl2N4O4S |
| Molecular Weight | 315.14 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | ethyl N-[(5,6-dichloropyrimidin-4-yl)sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)Nc1ncnc(Cl)c1Cl |
| InChI | InChI=1S/C7H8Cl2N4O4S/c1-2-17-7(14)13-18(15,16)12-6-4(8)5(9)10-3-11-6/h3H,2H2,1H3,(H,13,14)(H,10,11,12) |
| InChIKey | MYZGHTIZEHAJKX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.14 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |