C10H14BrN3O4S — CID 114461807
ethyl N-[(2-amino-6-bromo-4-methylphenyl)sulfamoyl]carbamate (PubChem CID 114461807) has the molecular formula C10H14BrN3O4S and a molecular weight of 352.21 g/mol. Its IUPAC name is ethyl N-[(2-amino-6-bromo-4-methylphenyl)sulfamoyl]carbamate.
| Compound Name | ethyl N-[(2-amino-6-bromo-4-methylphenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114461807 |
| Molecular Formula | C10H14BrN3O4S |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | ethyl N-[(2-amino-6-bromo-4-methylphenyl)sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)Nc1c(N)cc(C)cc1Br |
| InChI | InChI=1S/C10H14BrN3O4S/c1-3-18-10(15)14-19(16,17)13-9-7(11)4-6(2)5-8(9)12/h4-5,13H,3,12H2,1-2H3,(H,14,15) |
| InChIKey | SEFNFIDLBKMPEH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|