C10H13BrN2O5S — CID 114463849
ethyl N-[(2-bromo-5-methoxyphenyl)sulfamoyl]carbamate (PubChem CID 114463849) has the molecular formula C10H13BrN2O5S and a molecular weight of 353.19 g/mol. Its IUPAC name is ethyl N-[(2-bromo-5-methoxyphenyl)sulfamoyl]carbamate.
| Compound Name | ethyl N-[(2-bromo-5-methoxyphenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114463849 |
| Molecular Formula | C10H13BrN2O5S |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | ethyl N-[(2-bromo-5-methoxyphenyl)sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)Nc1cc(OC)ccc1Br |
| InChI | InChI=1S/C10H13BrN2O5S/c1-3-18-10(14)13-19(15,16)12-9-6-7(17-2)4-5-8(9)11/h4-6,12H,3H2,1-2H3,(H,13,14) |
| InChIKey | ZQGIDXSNYNEFFE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |