C10H12N2O7S — CID 107264892
3-(ethoxycarbonylsulfamoylamino)-4-hydroxybenzoic acid (PubChem CID 107264892) has the molecular formula C10H12N2O7S and a molecular weight of 304.28 g/mol. Its IUPAC name is 3-(ethoxycarbonylsulfamoylamino)-4-hydroxybenzoic acid.
| Compound Name | 3-(ethoxycarbonylsulfamoylamino)-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 107264892 |
| Molecular Formula | C10H12N2O7S |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 3-(ethoxycarbonylsulfamoylamino)-4-hydroxybenzoic acid |
| SMILES | CCOC(=O)NS(=O)(=O)Nc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C10H12N2O7S/c1-2-19-10(16)12-20(17,18)11-7-5-6(9(14)15)3-4-8(7)13/h3-5,11,13H,2H2,1H3,(H,12,16)(H,14,15) |
| InChIKey | HZMMPPGTCVHTSK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|