C9H14BrN3O2S — CID 114804993
3-bromo-2-N-(ethylsulfamoyl)-5-methylbenzene-1,2-diamine (PubChem CID 114804993) has the molecular formula C9H14BrN3O2S and a molecular weight of 308.20 g/mol. Its IUPAC name is 3-bromo-2-N-(ethylsulfamoyl)-5-methylbenzene-1,2-diamine.
| Compound Name | 3-bromo-2-N-(ethylsulfamoyl)-5-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 114804993 |
| Molecular Formula | C9H14BrN3O2S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 3-bromo-2-N-(ethylsulfamoyl)-5-methylbenzene-1,2-diamine |
| SMILES | CCNS(=O)(=O)Nc1c(N)cc(C)cc1Br |
| InChI | InChI=1S/C9H14BrN3O2S/c1-3-12-16(14,15)13-9-7(10)4-6(2)5-8(9)11/h4-5,12-13H,3,11H2,1-2H3 |
| InChIKey | CQWWICRFTHTLRT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|