C10H13Br2NO2S — CID 60640320
N-(2,6-dibromo-4-methylphenyl)propane-1-sulfonamide (PubChem CID 60640320) has the molecular formula C10H13Br2NO2S and a molecular weight of 371.09 g/mol. Its IUPAC name is N-(2,6-dibromo-4-methylphenyl)propane-1-sulfonamide.
| Compound Name | N-(2,6-dibromo-4-methylphenyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 60640320 |
| Molecular Formula | C10H13Br2NO2S |
| Molecular Weight | 371.09 g/mol |
| Exact Mass | 368.90 |
| IUPAC Name | N-(2,6-dibromo-4-methylphenyl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1c(Br)cc(C)cc1Br |
| InChI | InChI=1S/C10H13Br2NO2S/c1-3-4-16(14,15)13-10-8(11)5-7(2)6-9(10)12/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | OOOWSCYHWSINQP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.09 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |