C14H23BrN2O2S — CID 106072927
N-(2-bromo-4,6-dimethylphenyl)-4-(ethylamino)butane-1-sulfonamide (PubChem CID 106072927) has the molecular formula C14H23BrN2O2S and a molecular weight of 363.32 g/mol. Its IUPAC name is N-(2-bromo-4,6-dimethylphenyl)-4-(ethylamino)butane-1-sulfonamide.
| Compound Name | N-(2-bromo-4,6-dimethylphenyl)-4-(ethylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106072927 |
| Molecular Formula | C14H23BrN2O2S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | N-(2-bromo-4,6-dimethylphenyl)-4-(ethylamino)butane-1-sulfonamide |
| SMILES | CCNCCCCS(=O)(=O)Nc1c(C)cc(C)cc1Br |
| InChI | InChI=1S/C14H23BrN2O2S/c1-4-16-7-5-6-8-20(18,19)17-14-12(3)9-11(2)10-13(14)15/h9-10,16-17H,4-8H2,1-3H3 |
| InChIKey | VPAOYPIYOURKHL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|