C12H20BrN3O2S — CID 106076772
N-(5-bromo-3-methyl-2-pyridinyl)-4-(ethylamino)butane-1-sulfonamide (PubChem CID 106076772) has the molecular formula C12H20BrN3O2S and a molecular weight of 350.28 g/mol. Its IUPAC name is N-(5-bromo-3-methyl-2-pyridinyl)-4-(ethylamino)butane-1-sulfonamide.
| Compound Name | N-(5-bromo-3-methyl-2-pyridinyl)-4-(ethylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106076772 |
| Molecular Formula | C12H20BrN3O2S |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | N-(5-bromo-3-methyl-2-pyridinyl)-4-(ethylamino)butane-1-sulfonamide |
| SMILES | CCNCCCCS(=O)(=O)Nc1ncc(Br)cc1C |
| InChI | InChI=1S/C12H20BrN3O2S/c1-3-14-6-4-5-7-19(17,18)16-12-10(2)8-11(13)9-15-12/h8-9,14H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | SPAIZMFHNKJIGZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|