C14H15BrN2O2S — CID 81422841
N-(5-bromo-3-methyl-2-pyridinyl)-2-phenylethanesulfonamide (PubChem CID 81422841) has the molecular formula C14H15BrN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is N-(5-bromo-3-methyl-2-pyridinyl)-2-phenylethanesulfonamide.
| Compound Name | N-(5-bromo-3-methyl-2-pyridinyl)-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 81422841 |
| Molecular Formula | C14H15BrN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | N-(5-bromo-3-methyl-2-pyridinyl)-2-phenylethanesulfonamide |
| SMILES | Cc1cc(Br)cnc1NS(=O)(=O)CCc1ccccc1 |
| InChI | InChI=1S/C14H15BrN2O2S/c1-11-9-13(15)10-16-14(11)17-20(18,19)8-7-12-5-3-2-4-6-12/h2-6,9-10H,7-8H2,1H3,(H,16,17) |
| InChIKey | YMBXLJNPXZJRDZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |