C12H17Br3N2O2S — CID 106002477
4-(ethylamino)-N-(2,4,6-tribromophenyl)butane-1-sulfonamide (PubChem CID 106002477) has the molecular formula C12H17Br3N2O2S and a molecular weight of 493.06 g/mol. Its IUPAC name is 4-(ethylamino)-N-(2,4,6-tribromophenyl)butane-1-sulfonamide.
| Compound Name | 4-(ethylamino)-N-(2,4,6-tribromophenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106002477 |
| Molecular Formula | C12H17Br3N2O2S |
| Molecular Weight | 493.06 g/mol |
| Exact Mass | 489.86 |
| IUPAC Name | 4-(ethylamino)-N-(2,4,6-tribromophenyl)butane-1-sulfonamide |
| SMILES | CCNCCCCS(=O)(=O)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C12H17Br3N2O2S/c1-2-16-5-3-4-6-20(18,19)17-12-10(14)7-9(13)8-11(12)15/h7-8,16-17H,2-6H2,1H3 |
| InChIKey | GACZTVSEKAVLKL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.06 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|