C10H12Br3NO3S — CID 114134333
4-hydroxy-N-(2,4,6-tribromophenyl)butane-1-sulfonamide (PubChem CID 114134333) has the molecular formula C10H12Br3NO3S and a molecular weight of 465.99 g/mol. Its IUPAC name is 4-hydroxy-N-(2,4,6-tribromophenyl)butane-1-sulfonamide.
| Compound Name | 4-hydroxy-N-(2,4,6-tribromophenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 114134333 |
| Molecular Formula | C10H12Br3NO3S |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 462.81 |
| IUPAC Name | 4-hydroxy-N-(2,4,6-tribromophenyl)butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCO)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C10H12Br3NO3S/c11-7-5-8(12)10(9(13)6-7)14-18(16,17)4-2-1-3-15/h5-6,14-15H,1-4H2 |
| InChIKey | SPPPKCGPFBISPI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|