C10H12BrF2NO3S — CID 114135993
N-(4-bromo-2,5-difluorophenyl)-4-hydroxybutane-1-sulfonamide (PubChem CID 114135993) has the molecular formula C10H12BrF2NO3S and a molecular weight of 344.18 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-4-hydroxybutane-1-sulfonamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-4-hydroxybutane-1-sulfonamide |
|---|---|
| PubChem CID | 114135993 |
| Molecular Formula | C10H12BrF2NO3S |
| Molecular Weight | 344.18 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-4-hydroxybutane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCO)Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C10H12BrF2NO3S/c11-7-5-9(13)10(6-8(7)12)14-18(16,17)4-2-1-3-15/h5-6,14-15H,1-4H2 |
| InChIKey | ZEDPOCCQKYXNGV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|